C14H18N2O — CID 134695050
5-hexyl-3-pyridin-3-yl-1,2-oxazole (PubChem CID 134695050) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-hexyl-3-pyridin-3-yl-1,2-oxazole.
| Compound Name | 5-hexyl-3-pyridin-3-yl-1,2-oxazole |
|---|---|
| PubChem CID | 134695050 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 5-hexyl-3-pyridin-3-yl-1,2-oxazole |
| SMILES | CCCCCCc1cc(-c2cccnc2)no1 |
| InChI | InChI=1S/C14H18N2O/c1-2-3-4-5-8-13-10-14(16-17-13)12-7-6-9-15-11-12/h6-7,9-11H,2-5,8H2,1H3 |
| InChIKey | NPNRUEMRFFNHQD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|