C15H19NO — CID 15445646
5-hexyl-3-phenyl-1,2-oxazole (PubChem CID 15445646) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 5-hexyl-3-phenyl-1,2-oxazole.
| Compound Name | 5-hexyl-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 15445646 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 5-hexyl-3-phenyl-1,2-oxazole |
| SMILES | CCCCCCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C15H19NO/c1-2-3-4-8-11-14-12-15(16-17-14)13-9-6-5-7-10-13/h5-7,9-10,12H,2-4,8,11H2,1H3 |
| InChIKey | HBUDBELCFXDKSI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|