C13H23NO — CID 66668490
3,5-dipentyl-1,2-oxazole (PubChem CID 66668490) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3,5-dipentyl-1,2-oxazole.
| Compound Name | 3,5-dipentyl-1,2-oxazole |
|---|---|
| PubChem CID | 66668490 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3,5-dipentyl-1,2-oxazole |
| SMILES | CCCCCc1cc(CCCCC)on1 |
| InChI | InChI=1S/C13H23NO/c1-3-5-7-9-12-11-13(15-14-12)10-8-6-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | QKTRJLDPEQJXHR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|