About 2-(3-heptyl-1,2-oxazol-5-yl)ethanol
2-(3-heptyl-1,2-oxazol-5-yl)ethanol (PubChem CID 65017895) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-(3-heptyl-1,2-oxazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-heptyl-1,2-oxazol-5-yl)ethanol |
| PubChem CID | 65017895 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-(3-heptyl-1,2-oxazol-5-yl)ethanol |
| SMILES | CCCCCCCc1cc(CCO)on1 |
| InChI | InChI=1S/C12H21NO2/c1-2-3-4-5-6-7-11-10-12(8-9-14)15-13-11/h10,14H,2-9H2,1H3 |
| InChIKey | VXDKPZFCJRRLIL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-heptyl-1,2-oxazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-heptyl-1,2-oxazol-5-yl)ethanol?
The IUPAC name of 2-(3-heptyl-1,2-oxazol-5-yl)ethanol (CID 65017895) is 2-(3-heptyl-1,2-oxazol-5-yl)ethanol.
What is the SMILES notation for 2-(3-heptyl-1,2-oxazol-5-yl)ethanol?
The canonical SMILES for 2-(3-heptyl-1,2-oxazol-5-yl)ethanol is CCCCCCCc1cc(CCO)on1.
What is the InChIKey of 2-(3-heptyl-1,2-oxazol-5-yl)ethanol?
The InChIKey is VXDKPZFCJRRLIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-2-3-4-5-6-7-11-10-12(8-9-14)15-13-11/h10,14H,2-9H2,1H3.
What are the key properties of 2-(3-heptyl-1,2-oxazol-5-yl)ethanol?
2-(3-heptyl-1,2-oxazol-5-yl)ethanol has a molecular weight of 211.30 g/mol, XLogP of 2.72, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-heptyl-1,2-oxazol-5-yl)ethanol is sourced from PubChem (CID 65017895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).