C8H13NO — CID 19872036
3-butyl-5-methyl-1,2-oxazole (PubChem CID 19872036) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 3-butyl-5-methyl-1,2-oxazole.
| Compound Name | 3-butyl-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 19872036 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 3-butyl-5-methyl-1,2-oxazole |
| SMILES | CCCCc1cc(C)on1 |
| InChI | InChI=1S/C8H13NO/c1-3-4-5-8-6-7(2)10-9-8/h6H,3-5H2,1-2H3 |
| InChIKey | PTLSGDUXKJPKLO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |