C11H20N2O — CID 65427877
3-octyl-1,2-oxazol-5-amine (PubChem CID 65427877) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-octyl-1,2-oxazol-5-amine.
| Compound Name | 3-octyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 65427877 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-octyl-1,2-oxazol-5-amine |
| SMILES | CCCCCCCCc1cc(N)on1 |
| InChI | InChI=1S/C11H20N2O/c1-2-3-4-5-6-7-8-10-9-11(12)14-13-10/h9H,2-8,12H2,1H3 |
| InChIKey | YQTQEXGPNOGESW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|