C8H14N2O — CID 13168213
3-pentan-3-yl-1,2-oxazol-5-amine (PubChem CID 13168213) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-pentan-3-yl-1,2-oxazol-5-amine.
| Compound Name | 3-pentan-3-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 13168213 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 3-pentan-3-yl-1,2-oxazol-5-amine |
| SMILES | CCC(CC)c1cc(N)on1 |
| InChI | InChI=1S/C8H14N2O/c1-3-6(4-2)7-5-8(9)11-10-7/h5-6H,3-4,9H2,1-2H3 |
| InChIKey | WATBXBFPSOTARH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |