C19H33NO3 — CID 13169319
ethyl 5-tridecyl-1,2-oxazole-3-carboxylate (PubChem CID 13169319) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is ethyl 5-tridecyl-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-tridecyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 13169319 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | ethyl 5-tridecyl-1,2-oxazole-3-carboxylate |
| SMILES | CCCCCCCCCCCCCc1cc(C(=O)OCC)no1 |
| InChI | InChI=1S/C19H33NO3/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-16-18(20-23-17)19(21)22-4-2/h16H,3-15H2,1-2H3 |
| InChIKey | QZLHDXRWFSSDSJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|