C13H23N3O3 — CID 63575530
5-(octoxymethyl)-1,2-oxazole-3-carbohydrazide (PubChem CID 63575530) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 5-(octoxymethyl)-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-(octoxymethyl)-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63575530 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 5-(octoxymethyl)-1,2-oxazole-3-carbohydrazide |
| SMILES | CCCCCCCCOCc1cc(C(=O)NN)no1 |
| InChI | InChI=1S/C13H23N3O3/c1-2-3-4-5-6-7-8-18-10-11-9-12(16-19-11)13(17)15-14/h9H,2-8,10,14H2,1H3,(H,15,17) |
| InChIKey | FYAADIGWACKSHB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|