C11H18N2O2 — CID 160831155
5-ethyl-N-pentyl-1,2-oxazole-3-carboxamide (PubChem CID 160831155) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-ethyl-N-pentyl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-ethyl-N-pentyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 160831155 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 5-ethyl-N-pentyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(CC)on1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-5-6-7-12-11(14)10-8-9(4-2)15-13-10/h8H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | ADSMCHVNMLUBED-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|