C16H18N2O4 — CID 46087349
5-(1,3-benzodioxol-5-yl)-N-pentyl-1,2-oxazole-3-carboxamide (PubChem CID 46087349) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-pentyl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-pentyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 46087349 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-pentyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2ccc3c(c2)OCO3)on1 |
| InChI | InChI=1S/C16H18N2O4/c1-2-3-4-7-17-16(19)12-9-14(22-18-12)11-5-6-13-15(8-11)21-10-20-13/h5-6,8-9H,2-4,7,10H2,1H3,(H,17,19) |
| InChIKey | PCHUQDLARNEMPG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|