C19H16N2O4 — CID 15988831
5-(1,3-benzodioxol-5-yl)-N-(2-ethylphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 15988831) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-(2-ethylphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-(2-ethylphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 15988831 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-(2-ethylphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cc(-c2ccc3c(c2)OCO3)on1 |
| InChI | InChI=1S/C19H16N2O4/c1-2-12-5-3-4-6-14(12)20-19(22)15-10-17(25-21-15)13-7-8-16-18(9-13)24-11-23-16/h3-10H,2,11H2,1H3,(H,20,22) |
| InChIKey | ZANHTWYIAJCREI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |