C17H11ClN2O4 — CID 15988828
5-(1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 15988828) has the molecular formula C17H11ClN2O4 and a molecular weight of 342.74 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 15988828 |
| Molecular Formula | C17H11ClN2O4 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc(-c2ccc3c(c2)OCO3)on1 |
| InChI | InChI=1S/C17H11ClN2O4/c18-11-2-1-3-12(7-11)19-17(21)13-8-15(24-20-13)10-4-5-14-16(6-10)23-9-22-14/h1-8H,9H2,(H,19,21) |
| InChIKey | RNRYJSMYZALSSL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |