C16H10ClFN2O2 — CID 37341737
5-(3-chlorophenyl)-N-(3-fluorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 37341737) has the molecular formula C16H10ClFN2O2 and a molecular weight of 316.72 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-(3-fluorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-(3-fluorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 37341737 |
| Molecular Formula | C16H10ClFN2O2 |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-(3-chlorophenyl)-N-(3-fluorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc(-c2cccc(Cl)c2)on1 |
| InChI | InChI=1S/C16H10ClFN2O2/c17-11-4-1-3-10(7-11)15-9-14(20-22-15)16(21)19-13-6-2-5-12(18)8-13/h1-9H,(H,19,21) |
| InChIKey | QOAVJKFSMJCDSI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |