C16H10ClN3O4 — CID 31776990
5-(4-chlorophenyl)-N-(3-nitrophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 31776990) has the molecular formula C16H10ClN3O4 and a molecular weight of 343.73 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(3-nitrophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(3-nitrophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 31776990 |
| Molecular Formula | C16H10ClN3O4 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(3-nitrophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C16H10ClN3O4/c17-11-6-4-10(5-7-11)15-9-14(19-24-15)16(21)18-12-2-1-3-13(8-12)20(22)23/h1-9H,(H,18,21) |
| InChIKey | MMAUSPKMJCZLPR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|