C16H12N2O3 — CID 1093722
N-(3-hydroxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 1093722) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 1093722 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-(3-hydroxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H12N2O3/c19-13-8-4-7-12(9-13)17-16(20)14-10-15(21-18-14)11-5-2-1-3-6-11/h1-10,19H,(H,17,20) |
| InChIKey | GREYVCCHGLGSGQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |