C17H15N5O2 — CID 86567647
5-[4-(diaminomethylideneamino)phenyl]-N-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 86567647) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 5-[4-(diaminomethylideneamino)phenyl]-N-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[4-(diaminomethylideneamino)phenyl]-N-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 86567647 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-[4-(diaminomethylideneamino)phenyl]-N-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | NC(N)=Nc1ccc(-c2cc(C(=O)Nc3ccccc3)no2)cc1 |
| InChI | InChI=1S/C17H15N5O2/c18-17(19)21-13-8-6-11(7-9-13)15-10-14(22-24-15)16(23)20-12-4-2-1-3-5-12/h1-10H,(H,20,23)(H4,18,19,21) |
| InChIKey | JNQUYFYYPYBHBX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|