C16H11FN2O2 — CID 46480950
5-(2-fluorophenyl)-N-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 46480950) has the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 46480950 |
| Molecular Formula | C16H11FN2O2 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-(2-fluorophenyl)-N-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(-c2ccccc2F)on1 |
| InChI | InChI=1S/C16H11FN2O2/c17-13-9-5-4-8-12(13)15-10-14(19-21-15)16(20)18-11-6-2-1-3-7-11/h1-10H,(H,18,20) |
| InChIKey | WDVHSDSTCVZJKS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |