C16H11BrN2O3 — CID 135573197
N-(4-bromophenyl)-5-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 135573197) has the molecular formula C16H11BrN2O3 and a molecular weight of 359.18 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135573197 |
| Molecular Formula | C16H11BrN2O3 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | N-(4-bromophenyl)-5-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cc(-c2ccccc2O)on1 |
| InChI | InChI=1S/C16H11BrN2O3/c17-10-5-7-11(8-6-10)18-16(21)13-9-15(22-19-13)12-3-1-2-4-14(12)20/h1-9,20H,(H,18,21) |
| InChIKey | MAAOJPIKAWNXPU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |