C18H18ClN5O2 — CID 90644253
5-[4-(diaminomethylideneamino)phenyl]-N-(3-methylphenyl)-1,2-oxazole-3-carboxamide;hydrochloride (PubChem CID 90644253) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 5-[4-(diaminomethylideneamino)phenyl]-N-(3-methylphenyl)-1,2-oxazole-3-carboxamide;hydrochloride.
| Compound Name | 5-[4-(diaminomethylideneamino)phenyl]-N-(3-methylphenyl)-1,2-oxazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 90644253 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-[4-(diaminomethylideneamino)phenyl]-N-(3-methylphenyl)-1,2-oxazole-3-carboxamide;hydrochloride |
| SMILES | Cc1cccc(NC(=O)c2cc(-c3ccc(N=C(N)N)cc3)on2)c1.Cl |
| InChI | InChI=1S/C18H17N5O2.ClH/c1-11-3-2-4-14(9-11)21-17(24)15-10-16(25-23-15)12-5-7-13(8-6-12)22-18(19)20;/h2-10H,1H3,(H,21,24)(H4,19,20,22);1H |
| InChIKey | MYXACOOTDOGGGM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|