C20H19N3O4S — CID 110312981
N-[3-(1,1-dioxothiazinan-2-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 110312981) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiazinan-2-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(1,1-dioxothiazinan-2-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 110312981 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[3-(1,1-dioxothiazinan-2-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCCCS2(=O)=O)c1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H19N3O4S/c24-20(18-14-19(27-22-18)15-7-2-1-3-8-15)21-16-9-6-10-17(13-16)23-11-4-5-12-28(23,25)26/h1-3,6-10,13-14H,4-5,11-12H2,(H,21,24) |
| InChIKey | NHKJOQJWWLGBDB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |