C17H18N2O3S — CID 7686078
3-(1,1-dioxothiazinan-2-yl)-N-phenylbenzamide (PubChem CID 7686078) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-phenylbenzamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 7686078 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H18N2O3S/c20-17(18-15-8-2-1-3-9-15)14-7-6-10-16(13-14)19-11-4-5-12-23(19,21)22/h1-3,6-10,13H,4-5,11-12H2,(H,18,20) |
| InChIKey | FJGBVBHCLHVHJH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |