C16H15Cl2N3O3S — CID 41492455
N-(4-amino-3,5-dichlorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 41492455) has the molecular formula C16H15Cl2N3O3S and a molecular weight of 400.29 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 41492455 |
| Molecular Formula | C16H15Cl2N3O3S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | Nc1c(Cl)cc(NC(=O)c2cccc(N3CCCS3(=O)=O)c2)cc1Cl |
| InChI | InChI=1S/C16H15Cl2N3O3S/c17-13-8-11(9-14(18)15(13)19)20-16(22)10-3-1-4-12(7-10)21-5-2-6-25(21,23)24/h1,3-4,7-9H,2,5-6,19H2,(H,20,22) |
| InChIKey | GGENHXKGRKMSGA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|