C20H18ClN3O3S — CID 56530330
N-(4-chloro-2-pyrrol-1-ylphenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 56530330) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is N-(4-chloro-2-pyrrol-1-ylphenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(4-chloro-2-pyrrol-1-ylphenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 56530330 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-(4-chloro-2-pyrrol-1-ylphenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1-n1cccc1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C20H18ClN3O3S/c21-16-7-8-18(19(14-16)23-9-1-2-10-23)22-20(25)15-5-3-6-17(13-15)24-11-4-12-28(24,26)27/h1-3,5-10,13-14H,4,11-12H2,(H,22,25) |
| InChIKey | HQKCEJZSVSIFAG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |