C20H22N2O3S — CID 51309956
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 51309956) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 51309956 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | O=C(Nc1cccc2c1CCCC2)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20(21-19-11-4-7-15-6-1-2-10-18(15)19)16-8-3-9-17(14-16)22-12-5-13-26(22,24)25/h3-4,7-9,11,14H,1-2,5-6,10,12-13H2,(H,21,23) |
| InChIKey | LPHONCVGVULJGL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |