C16H15IN2O4S — CID 55815207
N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-iodobenzamide (PubChem CID 55815207) has the molecular formula C16H15IN2O4S and a molecular weight of 458.28 g/mol. Its IUPAC name is N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-iodobenzamide.
| Compound Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 55815207 |
| Molecular Formula | C16H15IN2O4S |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-iodobenzamide |
| SMILES | O=C(Nc1cc(N2CCCS2(=O)=O)ccc1O)c1cccc(I)c1 |
| InChI | InChI=1S/C16H15IN2O4S/c17-12-4-1-3-11(9-12)16(21)18-14-10-13(5-6-15(14)20)19-7-2-8-24(19,22)23/h1,3-6,9-10,20H,2,7-8H2,(H,18,21) |
| InChIKey | KKVWATBRYHZGEJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|