C23H20N4O4S — CID 55932965
4-(benzimidazol-1-yl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide (PubChem CID 55932965) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide.
| Compound Name | 4-(benzimidazol-1-yl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 55932965 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide |
| SMILES | O=C(Nc1cc(N2CCCS2(=O)=O)ccc1O)c1ccc(-n2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C23H20N4O4S/c28-22-11-10-18(27-12-3-13-32(27,30)31)14-20(22)25-23(29)16-6-8-17(9-7-16)26-15-24-19-4-1-2-5-21(19)26/h1-2,4-11,14-15,28H,3,12-13H2,(H,25,29) |
| InChIKey | WEXNVOKPBMKBHW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|