C15H15N3O3S — CID 18107159
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-pyridin-2-ylbenzamide (PubChem CID 18107159) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-pyridin-2-ylbenzamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 18107159 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-pyridin-2-ylbenzamide |
| SMILES | O=C(Nc1ccccn1)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C15H15N3O3S/c19-15(17-14-4-1-2-9-16-14)12-5-7-13(8-6-12)18-10-3-11-22(18,20)21/h1-2,4-9H,3,10-11H2,(H,16,17,19) |
| InChIKey | WYEYBVKRLVCZDU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |