C17H16F2N2O4S — CID 51246339
N-[2-(difluoromethoxy)phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 51246339) has the molecular formula C17H16F2N2O4S and a molecular weight of 382.39 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 51246339 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccccc1OC(F)F)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C17H16F2N2O4S/c18-17(19)25-15-5-2-1-4-14(15)20-16(22)12-6-8-13(9-7-12)21-10-3-11-26(21,23)24/h1-2,4-9,17H,3,10-11H2,(H,20,22) |
| InChIKey | VGXUZACNTMEXRA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |