C18H20N2O4S — CID 7686104
3-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyphenyl)benzamide (PubChem CID 7686104) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyphenyl)benzamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 7686104 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1cccc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-24-17-10-3-2-9-16(17)19-18(21)14-7-6-8-15(13-14)20-11-4-5-12-25(20,22)23/h2-3,6-10,13H,4-5,11-12H2,1H3,(H,19,21) |
| InChIKey | LEDQBQBYDQNWJV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |