C23H26N4O3S — CID 52655634
N-(1-cyclohexylbenzimidazol-2-yl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 52655634) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-(1-cyclohexylbenzimidazol-2-yl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(1-cyclohexylbenzimidazol-2-yl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 52655634 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-(1-cyclohexylbenzimidazol-2-yl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccccc2n1C1CCCCC1)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c28-22(17-11-13-18(14-12-17)26-15-6-16-31(26,29)30)25-23-24-20-9-4-5-10-21(20)27(23)19-7-2-1-3-8-19/h4-5,9-14,19H,1-3,6-8,15-16H2,(H,24,25,28) |
| InChIKey | YWEMTHGYILRTLF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |