C24H26N6O2 — CID 167835550
5-N-(1-cyclohexylbenzimidazol-2-yl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 167835550) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-N-(1-cyclohexylbenzimidazol-2-yl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-(1-cyclohexylbenzimidazol-2-yl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 167835550 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 5-N-(1-cyclohexylbenzimidazol-2-yl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)C1CC(C(=O)Nc2nc3ccccc3n2C2CCCCC2)=NN1c1ccccc1 |
| InChI | InChI=1S/C24H26N6O2/c25-22(31)21-15-19(28-30(21)17-11-5-2-6-12-17)23(32)27-24-26-18-13-7-8-14-20(18)29(24)16-9-3-1-4-10-16/h2,5-8,11-14,16,21H,1,3-4,9-10,15H2,(H2,25,31)(H,26,27,32) |
| InChIKey | BIHXNBKPGNWINX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |