C18H18N4O4S — CID 55561159
5-N-(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 55561159) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-N-(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 55561159 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 5-N-(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)C2=NN(c3ccccc3)C(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C18H18N4O4S/c1-27(25,26)14-9-7-12(8-10-14)20-18(24)15-11-16(17(19)23)22(21-15)13-5-3-2-4-6-13/h2-10,16H,11H2,1H3,(H2,19,23)(H,20,24) |
| InChIKey | FETBYIRGAPPJRC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |