C19H18N4O4 — CID 51934163
(4-acetamidophenyl) (3R)-3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 51934163) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is (4-acetamidophenyl) (3R)-3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | (4-acetamidophenyl) (3R)-3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 51934163 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (4-acetamidophenyl) (3R)-3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)C2=NN(c3ccccc3)[C@@H](C(N)=O)C2)cc1 |
| InChI | InChI=1S/C19H18N4O4/c1-12(24)21-13-7-9-15(10-8-13)27-19(26)16-11-17(18(20)25)23(22-16)14-5-3-2-4-6-14/h2-10,17H,11H2,1H3,(H2,20,25)(H,21,24)/t17-/m1/s1 |
| InChIKey | BFUAXKKFBRDNCK-QGZVFWFLSA-N |
| XLogP | 1.67 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|