C19H20N4O3 — CID 32935230
(3S)-5-N-(2-phenoxyethyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 32935230) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is (3S)-5-N-(2-phenoxyethyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | (3S)-5-N-(2-phenoxyethyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 32935230 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (3S)-5-N-(2-phenoxyethyl)-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CC(C(=O)NCCOc2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C19H20N4O3/c20-18(24)17-13-16(22-23(17)14-7-3-1-4-8-14)19(25)21-11-12-26-15-9-5-2-6-10-15/h1-10,17H,11-13H2,(H2,20,24)(H,21,25)/t17-/m0/s1 |
| InChIKey | HJTWFKZWGDAGKU-KRWDZBQOSA-N |
| XLogP | 1.30 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|