C20H21FN4O3 — CID 42949836
2-(4-fluorophenyl)-5-N-[2-(4-methylphenoxy)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 42949836) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-N-[2-(4-methylphenoxy)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-N-[2-(4-methylphenoxy)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 42949836 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-(4-fluorophenyl)-5-N-[2-(4-methylphenoxy)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | Cc1ccc(OCCNC(=O)C2=NN(c3ccc(F)cc3)C(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C20H21FN4O3/c1-13-2-8-16(9-3-13)28-11-10-23-20(27)17-12-18(19(22)26)25(24-17)15-6-4-14(21)5-7-15/h2-9,18H,10-12H2,1H3,(H2,22,26)(H,23,27) |
| InChIKey | HRPIUMRQUKFIDX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|