C20H21FN6O6S — CID 43057090
2-(4-fluorophenyl)-5-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 43057090) has the molecular formula C20H21FN6O6S and a molecular weight of 492.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 43057090 |
| Molecular Formula | C20H21FN6O6S |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-(4-fluorophenyl)-5-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)C2=NN(c3ccc(F)cc3)C(C(N)=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21FN6O6S/c1-34(32,33)14-6-7-15(17(10-14)27(30)31)23-8-9-24-20(29)16-11-18(19(22)28)26(25-16)13-4-2-12(21)3-5-13/h2-7,10,18,23H,8-9,11H2,1H3,(H2,22,28)(H,24,29) |
| InChIKey | KXKHDSQTGCXRCH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|