C16H16F2N4O5S2 — CID 24551377
2-(difluoromethylsulfanyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyridine-3-carboxamide (PubChem CID 24551377) has the molecular formula C16H16F2N4O5S2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24551377 |
| Molecular Formula | C16H16F2N4O5S2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)c2cccnc2SC(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16F2N4O5S2/c1-29(26,27)10-4-5-12(13(9-10)22(24)25)19-7-8-20-14(23)11-3-2-6-21-15(11)28-16(17)18/h2-6,9,16,19H,7-8H2,1H3,(H,20,23) |
| InChIKey | DYTKWEGOSDHZHE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|