C17H19N3O6S — CID 31644062
2-hydroxy-4-methyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide (PubChem CID 31644062) has the molecular formula C17H19N3O6S and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide.
| Compound Name | 2-hydroxy-4-methyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 31644062 |
| Molecular Formula | C17H19N3O6S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-hydroxy-4-methyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C17H19N3O6S/c1-11-3-5-13(16(21)9-11)17(22)19-8-7-18-14-6-4-12(27(2,25)26)10-15(14)20(23)24/h3-6,9-10,18,21H,7-8H2,1-2H3,(H,19,22) |
| InChIKey | FVHKBLKAPRGAPK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|