C17H19FN4O7S2 — CID 55430274
2-fluoro-5-(methylsulfamoyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide (PubChem CID 55430274) has the molecular formula C17H19FN4O7S2 and a molecular weight of 474.49 g/mol. Its IUPAC name is 2-fluoro-5-(methylsulfamoyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide.
| Compound Name | 2-fluoro-5-(methylsulfamoyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 55430274 |
| Molecular Formula | C17H19FN4O7S2 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 2-fluoro-5-(methylsulfamoyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)NCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19FN4O7S2/c1-19-31(28,29)12-3-5-14(18)13(9-12)17(23)21-8-7-20-15-6-4-11(30(2,26)27)10-16(15)22(24)25/h3-6,9-10,19-20H,7-8H2,1-2H3,(H,21,23) |
| InChIKey | XHMDQRJCYMEEPV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 164.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|