C11H17N3O4S — CID 60894165
N'-(4-methylsulfonyl-2-nitrophenyl)butane-1,4-diamine (PubChem CID 60894165) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is N'-(4-methylsulfonyl-2-nitrophenyl)butane-1,4-diamine.
| Compound Name | N'-(4-methylsulfonyl-2-nitrophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 60894165 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N'-(4-methylsulfonyl-2-nitrophenyl)butane-1,4-diamine |
| SMILES | CS(=O)(=O)c1ccc(NCCCCN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H17N3O4S/c1-19(17,18)9-4-5-10(11(8-9)14(15)16)13-7-3-2-6-12/h4-5,8,13H,2-3,6-7,12H2,1H3 |
| InChIKey | ZSYDYNGLPXNOMD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|