C8H13ClN4O4S — CID 155669962
4-(2-aminoethylamino)-3-nitrobenzenesulfonamide;hydrochloride (PubChem CID 155669962) has the molecular formula C8H13ClN4O4S and a molecular weight of 296.74 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-3-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 4-(2-aminoethylamino)-3-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 155669962 |
| Molecular Formula | C8H13ClN4O4S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-(2-aminoethylamino)-3-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O4S.ClH/c9-3-4-11-7-2-1-6(17(10,15)16)5-8(7)12(13)14;/h1-2,5,11H,3-4,9H2,(H2,10,15,16);1H |
| InChIKey | LBVIHUBHONSTJB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|