C10H16N4O4S — CID 43162671
4-(2-aminoethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide (PubChem CID 43162671) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-(2-aminoethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43162671 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(2-aminoethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NCCN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H16N4O4S/c1-13(2)19(17,18)8-3-4-9(12-6-5-11)10(7-8)14(15)16/h3-4,7,12H,5-6,11H2,1-2H3 |
| InChIKey | DKCZLRCUKUXRGC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|