C10H15N3O2 — CID 57324403
N'-(2-ethyl-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 57324403) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N'-(2-ethyl-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N'-(2-ethyl-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 57324403 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N'-(2-ethyl-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | CCc1cc([N+](=O)[O-])ccc1NCCN |
| InChI | InChI=1S/C10H15N3O2/c1-2-8-7-9(13(14)15)3-4-10(8)12-6-5-11/h3-4,7,12H,2,5-6,11H2,1H3 |
| InChIKey | DKULSJCXMCJPIU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|