C14H22N4O4 — CID 121482468
N'-(2,4-dinitrophenyl)octane-1,8-diamine (PubChem CID 121482468) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)octane-1,8-diamine.
| Compound Name | N'-(2,4-dinitrophenyl)octane-1,8-diamine |
|---|---|
| PubChem CID | 121482468 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | N'-(2,4-dinitrophenyl)octane-1,8-diamine |
| SMILES | NCCCCCCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N4O4/c15-9-5-3-1-2-4-6-10-16-13-8-7-12(17(19)20)11-14(13)18(21)22/h7-8,11,16H,1-6,9-10,15H2 |
| InChIKey | BOLZSQWSINYGIL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|