C12H15N4O6- — CID 71463471
3-amino-6-(2,4-dinitroanilino)hexanoate (PubChem CID 71463471) has the molecular formula C12H15N4O6- and a molecular weight of 311.27 g/mol. Its IUPAC name is 3-amino-6-(2,4-dinitroanilino)hexanoate.
| Compound Name | 3-amino-6-(2,4-dinitroanilino)hexanoate |
|---|---|
| PubChem CID | 71463471 |
| Molecular Formula | C12H15N4O6- |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-amino-6-(2,4-dinitroanilino)hexanoate |
| SMILES | NC(CCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C12H16N4O6/c13-8(6-12(17)18)2-1-5-14-10-4-3-9(15(19)20)7-11(10)16(21)22/h3-4,7-8,14H,1-2,5-6,13H2,(H,17,18)/p-1 |
| InChIKey | OFKKEEHBQICORT-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 164.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|