C11H17ClN4O4 — CID 21209129
N-(2,4-dinitrophenyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride (PubChem CID 21209129) has the molecular formula C11H17ClN4O4 and a molecular weight of 304.73 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-(2,4-dinitrophenyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 21209129 |
| Molecular Formula | C11H17ClN4O4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(2,4-dinitrophenyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
| SMILES | CN(C)CCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C11H16N4O4.ClH/c1-13(2)7-3-6-12-10-5-4-9(14(16)17)8-11(10)15(18)19;/h4-5,8,12H,3,6-7H2,1-2H3;1H |
| InChIKey | SATOLTDLHPFBBI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|