C11H16N4O7S — CID 154104155
2-(2,4-dinitroanilino)-N-(2-hydroxyethyl)-N-methylethanesulfonamide (PubChem CID 154104155) has the molecular formula C11H16N4O7S and a molecular weight of 348.34 g/mol. Its IUPAC name is 2-(2,4-dinitroanilino)-N-(2-hydroxyethyl)-N-methylethanesulfonamide.
| Compound Name | 2-(2,4-dinitroanilino)-N-(2-hydroxyethyl)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 154104155 |
| Molecular Formula | C11H16N4O7S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-(2,4-dinitroanilino)-N-(2-hydroxyethyl)-N-methylethanesulfonamide |
| SMILES | CN(CCO)S(=O)(=O)CCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N4O7S/c1-13(5-6-16)23(21,22)7-4-12-10-3-2-9(14(17)18)8-11(10)15(19)20/h2-3,8,12,16H,4-7H2,1H3 |
| InChIKey | YQRNZWKVEBPRJG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|