C10H13N3O6 — CID 66169292
3-(2,4-dinitroanilino)-2-methylpropane-1,2-diol (PubChem CID 66169292) has the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)-2-methylpropane-1,2-diol.
| Compound Name | 3-(2,4-dinitroanilino)-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 66169292 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(2,4-dinitroanilino)-2-methylpropane-1,2-diol |
| SMILES | CC(O)(CO)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O6/c1-10(15,6-14)5-11-8-3-2-7(12(16)17)4-9(8)13(18)19/h2-4,11,14-15H,5-6H2,1H3 |
| InChIKey | RVXAWLIGGSIDLO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|