C9H9F2N3O5 — CID 104858610
3-(2,4-dinitroanilino)-2,2-difluoropropan-1-ol (PubChem CID 104858610) has the molecular formula C9H9F2N3O5 and a molecular weight of 277.18 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)-2,2-difluoropropan-1-ol.
| Compound Name | 3-(2,4-dinitroanilino)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 104858610 |
| Molecular Formula | C9H9F2N3O5 |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-(2,4-dinitroanilino)-2,2-difluoropropan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(NCC(F)(F)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9F2N3O5/c10-9(11,5-15)4-12-7-2-1-6(13(16)17)3-8(7)14(18)19/h1-3,12,15H,4-5H2 |
| InChIKey | GMIWLFBDEIWITO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|